Type: Neutral
Formula: C17H23ClN2O3S
SMILES: |
Clc1cc(SCC(NC(=O)C)C(=O)NCC2OCCC2)ccc1C |
InChI: |
InChI=1/C17H23ClN2O3S/c1-11-5-6-14(8-15(11)18)24-10-16(20-12(2)21)17(22)19-9-13-4-3-7-23-13/h5-6,8,13,16H,3-4,7,9-10H2,1-2H3,(H,19,22)(H,20,21)/t13-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 370.901 g/mol | logS: -4.34856 | SlogP: 2.54042 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0619546 | Sterimol/B1: 2.34512 | Sterimol/B2: 3.20587 | Sterimol/B3: 4.29293 |
Sterimol/B4: 10.3612 | Sterimol/L: 16.5029 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 654.201 | Positive charged surface: 407.66 | Negative charged surface: 246.541 | Volume: 343.25 |
Hydrophobic surface: 544.218 | Hydrophilic surface: 109.983 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |