Type: Neutral
Formula: C18H26N2O3
SMILES: |
OCC(NC(=O)C(C)c1ccccc1)C(=O)N1CCCCCC1 |
InChI: |
InChI=1/C18H26N2O3/c1-14(15-9-5-4-6-10-15)17(22)19-16(13-21)18(23)20-11-7-2-3-8-12-20/h4-6,9-10,14,16,21H,2-3,7-8,11-13H2,1H3,(H,19,22)/t14-,16+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 318.417 g/mol | logS: -2.61421 | SlogP: 1.6698 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.085946 | Sterimol/B1: 2.0592 | Sterimol/B2: 3.88516 | Sterimol/B3: 4.58486 |
Sterimol/B4: 6.5096 | Sterimol/L: 16.8237 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 576.945 | Positive charged surface: 403.059 | Negative charged surface: 173.887 | Volume: 320.375 |
Hydrophobic surface: 469.929 | Hydrophilic surface: 107.016 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |