 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1ccc(cc1)C(=O)Nc1ccccc1C(=O)NC(C(C)C)C(=O)NNC(=O)c1cccn c1 |
| InChI: | InChI=1/C26H27N5O5/c1-16(2)22(26(35)31-30-24(33)18-7-6-14-27-15-18)29-25(34)20-8-4-5-9-21(20)28-23(32)17-10-12-19(36-3)13-11-17/h4-16,22H,1-3H3,(H,28,32)(H,29,34)(H,30,33)(H,31,35)/t22-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=163.106 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 489.532 g/mol | logS: -5.24895 | SlogP: 2.5581 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0628366 | Sterimol/B1: 2.52832 | Sterimol/B2: 6.29335 | Sterimol/B3: 6.35468 | |||
| Sterimol/B4: 8.35581 | Sterimol/L: 22.1161 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 804.7 | Positive charged surface: 515.384 | Negative charged surface: 289.316 | Volume: 458 | |||
| Hydrophobic surface: 612.114 | Hydrophilic surface: 192.586 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.