 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC1NC(N(CC(=O)N)C1=O)\C=C\c1[nH]cnc1 |
| InChI: | InChI=1/C17H19N5O3/c18-15(24)9-22-16(6-3-12-8-19-10-20-12)21-14(17(22)25)7-11-1-4-13(23)5-2-11/h1-6,8,10,14,16,21,23H,7,9H2,(H2,18,24)(H,19,20)/b6-3+/t14-,16-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=49.8385 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 341.371 g/mol | logS: -2.23047 | SlogP: -0.01703 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0767895 | Sterimol/B1: 3.57544 | Sterimol/B2: 3.58218 | Sterimol/B3: 4.86953 | |||
| Sterimol/B4: 6.66642 | Sterimol/L: 15.4343 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 605.244 | Positive charged surface: 417.242 | Negative charged surface: 188.002 | Volume: 318.625 | |||
| Hydrophobic surface: 359.715 | Hydrophilic surface: 245.529 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.