Type: Neutral
Formula: C14H16N4O3
SMILES: |
OCC(NC(=O)c1[nH]cnc1)C(=O)NCc1ccccc1 |
InChI: |
InChI=1/C14H16N4O3/c19-8-12(18-14(21)11-7-15-9-17-11)13(20)16-6-10-4-2-1-3-5-10/h1-5,7,9,12,19H,6,8H2,(H,15,17)(H,16,20)(H,18,21)/t12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 288.307 g/mol | logS: -2.02608 | SlogP: 0.0832 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0682894 | Sterimol/B1: 3.31542 | Sterimol/B2: 3.75507 | Sterimol/B3: 3.93661 |
Sterimol/B4: 4.53736 | Sterimol/L: 17.4378 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 545.735 | Positive charged surface: 367.264 | Negative charged surface: 178.471 | Volume: 268.5 |
Hydrophobic surface: 373.615 | Hydrophilic surface: 172.12 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |