Type: Neutral
Formula: C19H32N4O3
SMILES: |
OCC(NC(=O)c1[nH]cnc1)C(=O)NC1CCCCCCCCCCC1 |
InChI: |
InChI=1/C19H32N4O3/c24-13-17(23-18(25)16-12-20-14-21-16)19(26)22-15-10-8-6-4-2-1-3-5-7-9-11-15/h12,14-15,17,24H,1-11,13H2,(H,20,21)(H,22,26)(H,23,25)/t17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 364.49 g/mol | logS: -4.82064 | SlogP: 2.2899 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.200522 | Sterimol/B1: 3.36592 | Sterimol/B2: 4.2397 | Sterimol/B3: 5.83858 |
Sterimol/B4: 6.20841 | Sterimol/L: 15.7897 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 607.124 | Positive charged surface: 456.71 | Negative charged surface: 150.415 | Volume: 365.625 |
Hydrophobic surface: 461.691 | Hydrophilic surface: 145.433 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |