 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(N1CCn2c(ccc2)C1c1ccccc1)CN(C(C)C)C(=O)NC1CCCCC1 |
| InChI: | InChI=1/C25H34N4O2/c1-19(2)29(25(31)26-21-12-7-4-8-13-21)18-23(30)28-17-16-27-15-9-14-22(27)24(28)20-10-5-3-6-11-20/h3,5-6,9-11,14-15,19,21,24H,4,7-8,12-13,16-18H2,1-2H3,(H,26,31)/t24-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=67.2187 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 422.573 g/mol | logS: -3.86527 | SlogP: 4.5343 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0836685 | Sterimol/B1: 2.38812 | Sterimol/B2: 3.58622 | Sterimol/B3: 5.41612 | |||
| Sterimol/B4: 9.78422 | Sterimol/L: 18.2191 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 729.302 | Positive charged surface: 498.159 | Negative charged surface: 231.143 | Volume: 432.25 | |||
| Hydrophobic surface: 630.639 | Hydrophilic surface: 98.663 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.