 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1C2=C(N=C(C)C(C(OCCOC)=O)C2c2cc3c4c(n(c3cc2)CC)cccc4)CCC1 |
| InChI: | InChI=1/C28H30N2O4/c1-4-30-22-10-6-5-8-19(22)20-16-18(12-13-23(20)30)26-25(28(32)34-15-14-33-3)17(2)29-21-9-7-11-24(31)27(21)26/h5-6,8,10,12-13,16,25-26H,4,7,9,11,14-15H2,1-3H3/t25-,26-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=109.669 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 458.558 g/mol | logS: -5.56864 | SlogP: 5.4518 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.249391 | Sterimol/B1: 2.67049 | Sterimol/B2: 5.19118 | Sterimol/B3: 5.98895 | |||
| Sterimol/B4: 8.02243 | Sterimol/L: 14.8327 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 679.53 | Positive charged surface: 492.734 | Negative charged surface: 183.734 | Volume: 444.5 | |||
| Hydrophobic surface: 620.113 | Hydrophilic surface: 59.417 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
