Type: Neutral
Formula: C9H11BrN2O5
SMILES: |
BrC1C(O)C(OC1CO)N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C9H11BrN2O5/c10-6-4(3-13)17-8(7(6)15)12-2-1-5(14)11-9(12)16/h1-2,4,6-8,13,15H,3H2,(H,11,14,16)/t4-,6-,7+,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 307.1 g/mol | logS: -1.16772 | SlogP: -0.6866 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.166463 | Sterimol/B1: 2.51191 | Sterimol/B2: 4.29078 | Sterimol/B3: 4.68263 |
Sterimol/B4: 4.8079 | Sterimol/L: 12.2488 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 434.845 | Positive charged surface: 235.535 | Negative charged surface: 199.31 | Volume: 216.75 |
Hydrophobic surface: 154.364 | Hydrophilic surface: 280.481 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |