 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC1CC(O)C(\C=C/C(O)CCc2ccccc2)C1CCOCCCC(=O)N |
| InChI: | InChI=1/C22H33NO5/c23-22(27)7-4-13-28-14-12-19-18(20(25)15-21(19)26)11-10-17(24)9-8-16-5-2-1-3-6-16/h1-3,5-6,10-11,17-21,24-26H,4,7-9,12-15H2,(H2,23,27)/b11-10-/t17-,18+,19+,20+,21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=79.5017 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 391.508 g/mol | logS: -2.40996 | SlogP: 1.56637 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0725871 | Sterimol/B1: 2.96825 | Sterimol/B2: 3.31552 | Sterimol/B3: 4.92404 | |||
| Sterimol/B4: 10.3613 | Sterimol/L: 18.598 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 721.083 | Positive charged surface: 530.021 | Negative charged surface: 191.062 | Volume: 396.75 | |||
| Hydrophobic surface: 490.969 | Hydrophilic surface: 230.114 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.