Type: Neutral
Formula: C15H19N3O4
SMILES: |
Oc1cc2c([nH]cc2CCNC(=O)C(N)CCC(O)=O)cc1 |
InChI: |
InChI=1/C15H19N3O4/c16-12(2-4-14(20)21)15(22)17-6-5-9-8-18-13-3-1-10(19)7-11(9)13/h1,3,7-8,12,18-19H,2,4-6,16H2,(H,17,22)(H,20,21)/t12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 305.334 g/mol | logS: -1.29132 | SlogP: 0.72427 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.034985 | Sterimol/B1: 3.13652 | Sterimol/B2: 3.55749 | Sterimol/B3: 3.99731 |
Sterimol/B4: 5.53007 | Sterimol/L: 18.1245 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 571.31 | Positive charged surface: 367.431 | Negative charged surface: 199.157 | Volume: 283.75 |
Hydrophobic surface: 281.64 | Hydrophilic surface: 289.67 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |