Type: Neutral
Formula: C13H13ClN2O5S
SMILES: |
Clc1sc(cc1)C1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O |
InChI: |
InChI=1/C13H13ClN2O5S/c14-10-2-1-9(22-10)6-4-16(13(20)15-12(6)19)11-3-7(18)8(5-17)21-11/h1-2,4,7-8,11,17-18H,3,5H2,(H,15,19,20)/t7-,8+,11+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 344.775 g/mol | logS: -2.90567 | SlogP: 0.7624 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0998127 | Sterimol/B1: 2.94493 | Sterimol/B2: 3.30927 | Sterimol/B3: 4.29292 |
Sterimol/B4: 4.83421 | Sterimol/L: 16.3217 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 537.179 | Positive charged surface: 284.166 | Negative charged surface: 253.013 | Volume: 276.625 |
Hydrophobic surface: 332.759 | Hydrophilic surface: 204.42 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |