Type: Neutral
Formula: C11H13N5O
SMILES: |
O=C1N2C3(N=C(NC3c3c1[nH]cc3)N)CCC2 |
InChI: |
InChI=1/C11H13N5O/c12-10-14-8-6-2-4-13-7(6)9(17)16-5-1-3-11(8,16)15-10/h2,4,8,13H,1,3,5H2,(H3,12,14,15)/t8-,11+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 231.259 g/mol | logS: -1.11529 | SlogP: 0.0151 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.227883 | Sterimol/B1: 2.81541 | Sterimol/B2: 4.29659 | Sterimol/B3: 4.45781 |
Sterimol/B4: 5.25286 | Sterimol/L: 11.6221 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 418.461 | Positive charged surface: 292.484 | Negative charged surface: 125.977 | Volume: 207.625 |
Hydrophobic surface: 208.939 | Hydrophilic surface: 209.522 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |