Type: Neutral
Formula: C21H26N2O2
SMILES: |
OC(=O)C1N(CCC1)C(c1cc(ccc1)C)c1ccc(N(C)C)cc1 |
InChI: |
InChI=1/C21H26N2O2/c1-15-6-4-7-17(14-15)20(23-13-5-8-19(23)21(24)25)16-9-11-18(12-10-16)22(2)3/h4,6-7,9-12,14,19-20H,5,8,13H2,1-3H3,(H,24,25)/t19-,20-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 338.451 g/mol | logS: -3.97378 | SlogP: 3.79492 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.179954 | Sterimol/B1: 2.31777 | Sterimol/B2: 2.76069 | Sterimol/B3: 5.64615 |
Sterimol/B4: 9.9263 | Sterimol/L: 13.8468 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 600.005 | Positive charged surface: 445.156 | Negative charged surface: 154.849 | Volume: 346.5 |
Hydrophobic surface: 535.439 | Hydrophilic surface: 64.566 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |