Type: Neutral
Formula: C13H23NO9
SMILES: |
O1C(CO)C(O)C(O)C(NC)C1OC(C(O)(C(O)C)C=O)C=O |
InChI: |
InChI=1/C13H23NO9/c1-6(18)13(21,5-17)8(4-16)23-12-9(14-2)11(20)10(19)7(3-15)22-12/h4-12,14-15,18-21H,3H2,1-2H3/t6-,7+,8-,9-,10-,11+,12-,13+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 337.325 g/mol | logS: 0.94806 | SlogP: -4.0917 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.171282 | Sterimol/B1: 3.10305 | Sterimol/B2: 4.25914 | Sterimol/B3: 4.83863 |
Sterimol/B4: 6.02166 | Sterimol/L: 12.8516 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 517.624 | Positive charged surface: 394.797 | Negative charged surface: 122.827 | Volume: 294.625 |
Hydrophobic surface: 241.479 | Hydrophilic surface: 276.145 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 10 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 8 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |