Type: Neutral
Formula: C12H18N4O3
SMILES: |
OCC(NC(=O)c1[nH]cnc1)C(=O)NC1CCCC1 |
InChI: |
InChI=1/C12H18N4O3/c17-6-10(12(19)15-8-3-1-2-4-8)16-11(18)9-5-13-7-14-9/h5,7-8,10,17H,1-4,6H2,(H,13,14)(H,15,19)(H,16,18)/t10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 266.301 g/mol | logS: -1.2141 | SlogP: -0.4408 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0816653 | Sterimol/B1: 2.93557 | Sterimol/B2: 3.65636 | Sterimol/B3: 4.18526 |
Sterimol/B4: 4.70009 | Sterimol/L: 15.6006 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 500.886 | Positive charged surface: 380.573 | Negative charged surface: 120.313 | Volume: 251.25 |
Hydrophobic surface: 339.229 | Hydrophilic surface: 161.657 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |