Type: Neutral
Formula: C16H22N2O3S
SMILES: |
S(CC(NC(=O)C)C(=O)NCC1OCCC1)c1ccccc1 |
InChI: |
InChI=1/C16H22N2O3S/c1-12(19)18-15(11-22-14-7-3-2-4-8-14)16(20)17-10-13-6-5-9-21-13/h2-4,7-8,13,15H,5-6,9-11H2,1H3,(H,17,20)(H,18,19)/t13-,15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 322.429 g/mol | logS: -3.4538 | SlogP: 1.5786 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0695438 | Sterimol/B1: 2.29982 | Sterimol/B2: 2.57876 | Sterimol/B3: 4.32365 |
Sterimol/B4: 10.1172 | Sterimol/L: 16.0961 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 600.977 | Positive charged surface: 401.512 | Negative charged surface: 199.465 | Volume: 311.75 |
Hydrophobic surface: 491.544 | Hydrophilic surface: 109.433 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |