Type: Neutral
Formula: C14H24N4O4
SMILES: |
O=C(NC(C(=O)NC(C(=O)NC)C)C)C1N(CCC1)C(=O)C |
InChI: |
InChI=1/C14H24N4O4/c1-8(12(20)15-4)16-13(21)9(2)17-14(22)11-6-5-7-18(11)10(3)19/h8-9,11H,5-7H2,1-4H3,(H,15,20)(H,16,21)(H,17,22)/t8-,9-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 312.37 g/mol | logS: -1.38899 | SlogP: -1.2473 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0301612 | Sterimol/B1: 2.22488 | Sterimol/B2: 2.65523 | Sterimol/B3: 3.96923 |
Sterimol/B4: 6.46962 | Sterimol/L: 18.1352 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 589.857 | Positive charged surface: 433.724 | Negative charged surface: 156.133 | Volume: 299.5 |
Hydrophobic surface: 416.15 | Hydrophilic surface: 173.707 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |