 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | ClCC(=O)C(NC(C(=O)NC(=O)C(N)C)C)Cc1ccccc1 |
| InChI: | InChI=1/C16H22ClN3O3/c1-10(18)15(22)20-16(23)11(2)19-13(14(21)9-17)8-12-6-4-3-5-7-12/h3-7,10-11,13,19H,8-9,18H2,1-2H3,(H,20,22,23)/t10-,11-,13-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=110.017 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 339.823 g/mol | logS: -3.18914 | SlogP: 0.37367 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.107416 | Sterimol/B1: 2.14665 | Sterimol/B2: 5.14772 | Sterimol/B3: 6.28426 | |||
| Sterimol/B4: 6.9878 | Sterimol/L: 14.3127 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 592.308 | Positive charged surface: 338.593 | Negative charged surface: 253.715 | Volume: 320.125 | |||
| Hydrophobic surface: 353.721 | Hydrophilic surface: 238.587 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
