 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)C1N(C2C(C1)CCCC2)C(=O)C(NC(CCc1ccccc1)C(O)=O)C |
| InChI: | InChI=1/C22H30N2O5/c1-14(23-17(21(26)27)12-11-15-7-3-2-4-8-15)20(25)24-18-10-6-5-9-16(18)13-19(24)22(28)29/h2-4,7-8,14,16-19,23H,5-6,9-13H2,1H3,(H,26,27)(H,28,29)/t14-,16+,17-,18+,19+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=183.947 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 402.491 g/mol | logS: -3.4704 | SlogP: 2.29477 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.138844 | Sterimol/B1: 2.69384 | Sterimol/B2: 3.87006 | Sterimol/B3: 6.15059 | |||
| Sterimol/B4: 8.38513 | Sterimol/L: 16.4836 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 646.619 | Positive charged surface: 417.368 | Negative charged surface: 229.252 | Volume: 382.25 | |||
| Hydrophobic surface: 456.598 | Hydrophilic surface: 190.021 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
