 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C\1CC(C=C(NC(C(O)=O)C)/C/1=C(/O)\CCC)c1ccccc1 |
| InChI: | InChI=1/C19H23NO4/c1-3-7-16(21)18-15(20-12(2)19(23)24)10-14(11-17(18)22)13-8-5-4-6-9-13/h4-6,8-10,12,14,20-21H,3,7,11H2,1-2H3,(H,23,24)/b18-16+/t12-,14+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=107.217 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 329.396 g/mol | logS: -3.23178 | SlogP: 3.3018 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.266132 | Sterimol/B1: 2.43923 | Sterimol/B2: 4.35256 | Sterimol/B3: 4.57127 | |||
| Sterimol/B4: 9.9175 | Sterimol/L: 13.6335 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 574.158 | Positive charged surface: 375.798 | Negative charged surface: 198.36 | Volume: 320.625 | |||
| Hydrophobic surface: 391.356 | Hydrophilic surface: 182.802 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
