Type: Neutral
Formula: C17H21N3O2
SMILES: |
o1cc(nc1-c1ccccc1N)C(=O)NC1CCCCC1C |
InChI: |
InChI=1/C17H21N3O2/c1-11-6-2-5-9-14(11)19-16(21)15-10-22-17(20-15)12-7-3-4-8-13(12)18/h3-4,7-8,10-11,14H,2,5-6,9,18H2,1H3,(H,19,21)/t11-,14+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 299.374 g/mol | logS: -4.57791 | SlogP: 3.2323 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.122901 | Sterimol/B1: 2.36543 | Sterimol/B2: 3.29586 | Sterimol/B3: 6.19461 |
Sterimol/B4: 6.40456 | Sterimol/L: 14.4778 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 554.811 | Positive charged surface: 361.58 | Negative charged surface: 193.232 | Volume: 298.875 |
Hydrophobic surface: 440.512 | Hydrophilic surface: 114.299 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |