Type: Neutral
Formula: C14H21N5O5
SMILES: |
O1C(CO)C(O)CC1N1C2N=C(NC(=O)C2N=C1)NC(=O)C(C)C |
InChI: |
InChI=1/C14H21N5O5/c1-6(2)12(22)17-14-16-11-10(13(23)18-14)15-5-19(11)9-3-7(21)8(4-20)24-9/h5-11,20-21H,3-4H2,1-2H3,(H2,16,17,18,22,23)/t7-,8-,9-,10-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 339.352 g/mol | logS: -1.08956 | SlogP: -2.2488 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.130274 | Sterimol/B1: 2.8936 | Sterimol/B2: 4.53721 | Sterimol/B3: 6.08218 |
Sterimol/B4: 6.21424 | Sterimol/L: 13.1582 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 530.613 | Positive charged surface: 400.512 | Negative charged surface: 130.102 | Volume: 302.875 |
Hydrophobic surface: 263.94 | Hydrophilic surface: 266.673 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |