Type: Neutral
Formula: C14H25NO9
SMILES: |
O1C(COC(=O)C(NC(OC(C)(C)C)=O)C)C(O)C(O)C(O)C1O |
InChI: |
InChI=1/C14H25NO9/c1-6(15-13(21)24-14(2,3)4)11(19)22-5-7-8(16)9(17)10(18)12(20)23-7/h6-10,12,16-18,20H,5H2,1-4H3,(H,15,21)/t6-,7-,8-,9+,10-,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 351.352 g/mol | logS: -0.91899 | SlogP: -1.7573 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0474497 | Sterimol/B1: 1.969 | Sterimol/B2: 4.1243 | Sterimol/B3: 5.07578 |
Sterimol/B4: 5.88521 | Sterimol/L: 18.9075 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 621.504 | Positive charged surface: 441.702 | Negative charged surface: 179.802 | Volume: 315.125 |
Hydrophobic surface: 294.709 | Hydrophilic surface: 326.795 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |