 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C(O)C(O)C1N1C(=O)C(CC)(c2ccccc2)C(=O)NC1=O |
| InChI: | InChI=1/C18H22N2O8/c1-2-18(9-6-4-3-5-7-9)15(25)19-17(27)20(16(18)26)14-13(24)12(23)11(22)10(8-21)28-14/h3-7,10-14,21-24H,2,8H2,1H3,(H,19,25,27)/t10-,11-,12+,13-,14+,18-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=199.335 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 394.38 g/mol | logS: -2.20477 | SlogP: -1.7873 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.247632 | Sterimol/B1: 2.56069 | Sterimol/B2: 3.67053 | Sterimol/B3: 6.13955 | |||
| Sterimol/B4: 6.70381 | Sterimol/L: 14.4938 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 553.988 | Positive charged surface: 359.169 | Negative charged surface: 194.819 | Volume: 333.375 | |||
| Hydrophobic surface: 300.189 | Hydrophilic surface: 253.799 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.