 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(n2c3c(nc2)cccc3)C(O)C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C12H15N2O7P/c15-10-9(5-20-22(17,18)19)21-12(11(10)16)14-6-13-7-3-1-2-4-8(7)14/h1-4,6,9-12,15-16H,5H2,(H2,17,18,19)/p-2/t9-,10-,11-,12+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=51.1804 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 328.217 g/mol | logS: -1.1938 | SlogP: -2.4739 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0954673 | Sterimol/B1: 3.39246 | Sterimol/B2: 4.18105 | Sterimol/B3: 4.34333 | |||
| Sterimol/B4: 4.34407 | Sterimol/L: 16.0352 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 511.532 | Positive charged surface: 252.679 | Negative charged surface: 258.853 | Volume: 261.25 | |||
| Hydrophobic surface: 263.769 | Hydrophilic surface: 247.763 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
