 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(c2c(CCC1NC(CCCC[NH3+])C(=O)[O-])cccc2)CC(=O)[O-] |
| InChI: | InChI=1/C18H25N3O5/c19-10-4-3-6-14(18(25)26)20-13-9-8-12-5-1-2-7-15(12)21(17(13)24)11-16(22)23/h1-2,5,7,13-14,20H,3-4,6,8-11,19H2,(H,22,23)(H,25,26)/p-1/t13-,14+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=109.68 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 362.406 g/mol | logS: -2.41842 | SlogP: -2.79543 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0724625 | Sterimol/B1: 3.50581 | Sterimol/B2: 4.08443 | Sterimol/B3: 4.43082 | |||
| Sterimol/B4: 7.12605 | Sterimol/L: 17.2887 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 625.231 | Positive charged surface: 388.794 | Negative charged surface: 236.437 | Volume: 341.75 | |||
| Hydrophobic surface: 356.745 | Hydrophilic surface: 268.486 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 4 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
