Type: Neutral
Formula: C17H18N6O4
SMILES: |
O1C(CO)C(n2nncc2-c2ncccc2)CC1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C17H18N6O4/c1-10-8-22(17(26)20-16(10)25)15-6-12(14(9-24)27-15)23-13(7-19-21-23)11-4-2-3-5-18-11/h2-5,7-8,12,14-15,24H,6,9H2,1H3,(H,20,25,26)/t12-,14+,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 370.369 g/mol | logS: -1.24594 | SlogP: 0.5396 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.155916 | Sterimol/B1: 2.94128 | Sterimol/B2: 4.89828 | Sterimol/B3: 5.54864 |
Sterimol/B4: 6.09735 | Sterimol/L: 15.6773 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 588.111 | Positive charged surface: 371.284 | Negative charged surface: 216.827 | Volume: 323.375 |
Hydrophobic surface: 382.866 | Hydrophilic surface: 205.245 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |