 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C(O)C(O)C1NC(=O)NC(=O)C(CC)c1ccccc1 |
| InChI: | InChI=1/C17H24N2O7/c1-2-10(9-6-4-3-5-7-9)15(24)18-17(25)19-16-14(23)13(22)12(21)11(8-20)26-16/h3-7,10-14,16,20-23H,2,8H2,1H3,(H2,18,19,24,25)/t10-,11+,12+,13-,14+,16+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=79.7129 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 368.386 g/mol | logS: -1.90005 | SlogP: -1.1941 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.063426 | Sterimol/B1: 2.53956 | Sterimol/B2: 2.5588 | Sterimol/B3: 5.82678 | |||
| Sterimol/B4: 7.75628 | Sterimol/L: 17.5942 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 631.346 | Positive charged surface: 429.219 | Negative charged surface: 202.127 | Volume: 334.375 | |||
| Hydrophobic surface: 351.951 | Hydrophilic surface: 279.395 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.