 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(Cc1ccccc1)C(=O)[O-])C(NC(=O)Nc1ccccc1)C |
| InChI: | InChI=1/C19H21N3O4/c1-13(20-19(26)21-15-10-6-3-7-11-15)17(23)22-16(18(24)25)12-14-8-4-2-5-9-14/h2-11,13,16H,12H2,1H3,(H,22,23)(H,24,25)(H2,20,21,26)/p-1/t13-,16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=49.061 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 354.386 g/mol | logS: -4.01363 | SlogP: 0.67397 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0693399 | Sterimol/B1: 2.09018 | Sterimol/B2: 2.75754 | Sterimol/B3: 4.32219 | |||
| Sterimol/B4: 9.26026 | Sterimol/L: 17.6471 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 622.69 | Positive charged surface: 344.482 | Negative charged surface: 278.208 | Volume: 342.75 | |||
| Hydrophobic surface: 450.139 | Hydrophilic surface: 172.551 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
