 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(CC)c1cc(ccc1O)C1N(CCC2(O)C1CCCC2)C\C=C/c1ccccc1 |
| InChI: | InChI=1/C26H33NO3/c1-2-30-24-19-21(13-14-23(24)28)25-22-12-6-7-15-26(22,29)16-18-27(25)17-8-11-20-9-4-3-5-10-20/h3-5,8-11,13-14,19,22,25,28-29H,2,6-7,12,15-18H2,1H3/b11-8-/t22-,25+,26+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=251.656 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 407.554 g/mol | logS: -5.03946 | SlogP: 5.2679 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.251527 | Sterimol/B1: 2.48812 | Sterimol/B2: 3.698 | Sterimol/B3: 6.23331 | |||
| Sterimol/B4: 9.22708 | Sterimol/L: 14.8995 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 677.39 | Positive charged surface: 475.662 | Negative charged surface: 201.729 | Volume: 409.5 | |||
| Hydrophobic surface: 565.959 | Hydrophilic surface: 111.431 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
