Type: Neutral
Formula: C19H29N3O5
SMILES: |
O(C(C)(C)C)C(=O)NC(Cc1ccccc1)C(=O)NNC(OC(C)(C)C)=O |
InChI: |
InChI=1/C19H29N3O5/c1-18(2,3)26-16(24)20-14(12-13-10-8-7-9-11-13)15(23)21-22-17(25)27-19(4,5)6/h7-11,14H,12H2,1-6H3,(H,20,24)(H,21,23)(H,22,25)/t14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 379.457 g/mol | logS: -4.16644 | SlogP: 2.67827 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0599366 | Sterimol/B1: 2.00281 | Sterimol/B2: 3.19827 | Sterimol/B3: 5.57728 |
Sterimol/B4: 6.98155 | Sterimol/L: 17.9602 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 658.934 | Positive charged surface: 433.742 | Negative charged surface: 225.193 | Volume: 369.25 |
Hydrophobic surface: 434.905 | Hydrophilic surface: 224.029 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |