Type: Neutral
Formula: C17H19N3O5S
SMILES: |
S(=O)(=O)(N1CC(O)CC1C(=O)Nc1cccnc1)c1ccc(OC)cc1 |
InChI: |
InChI=1/C17H19N3O5S/c1-25-14-4-6-15(7-5-14)26(23,24)20-11-13(21)9-16(20)17(22)19-12-3-2-8-18-10-12/h2-8,10,13,16,21H,9,11H2,1H3,(H,19,22)/t13-,16+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 377.421 g/mol | logS: -2.23518 | SlogP: 0.8528 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0909646 | Sterimol/B1: 2.83297 | Sterimol/B2: 3.15346 | Sterimol/B3: 5.28357 |
Sterimol/B4: 8.98246 | Sterimol/L: 16.946 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 614.138 | Positive charged surface: 419.447 | Negative charged surface: 194.691 | Volume: 330.375 |
Hydrophobic surface: 464.764 | Hydrophilic surface: 149.374 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |