 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(n2c3c(nc2)cc(OC)cc3)C([O-])C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C13H16N2O8P/c1-21-7-2-3-9-8(4-7)14-6-15(9)13-12(17)11(16)10(23-13)5-22-24(18,19)20/h2-4,6,10-13,16H,5H2,1H3,(H2,18,19,20)/q-1/p-2/t10-,11-,12-,13+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=69.4173 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 357.235 g/mol | logS: -1.3157 | SlogP: -2.0271 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0838374 | Sterimol/B1: 3.6206 | Sterimol/B2: 3.65413 | Sterimol/B3: 4.68366 | |||
| Sterimol/B4: 5.40657 | Sterimol/L: 18.1121 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 555.762 | Positive charged surface: 292.259 | Negative charged surface: 263.504 | Volume: 281.875 | |||
| Hydrophobic surface: 307.811 | Hydrophilic surface: 247.951 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
