Type: Neutral
Formula: C17H15ClFN3O3
SMILES: |
Clc1ccc(nc1)NC(=O)NC1CC1c1c(O)c(ccc1F)C(=O)C |
InChI: |
InChI=1/C17H15ClFN3O3/c1-8(23)10-3-4-12(19)15(16(10)24)11-6-13(11)21-17(25)22-14-5-2-9(18)7-20-14/h2-5,7,11,13,24H,6H2,1H3,(H2,20,21,22,25)/t11-,13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 363.776 g/mol | logS: -3.51544 | SlogP: 3.4599 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.055955 | Sterimol/B1: 2.30945 | Sterimol/B2: 3.71802 | Sterimol/B3: 4.97761 |
Sterimol/B4: 5.51005 | Sterimol/L: 19.6249 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 606.766 | Positive charged surface: 336.312 | Negative charged surface: 270.454 | Volume: 313.5 |
Hydrophobic surface: 431.026 | Hydrophilic surface: 175.74 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |