Type: Neutral
Formula: C7H11O8P
SMILES: |
P(OC1CC(=CC(O)C1O)C(O)=O)(O)(O)=O |
InChI: |
InChI=1/C7H11O8P/c8-4-1-3(7(10)11)2-5(6(4)9)15-16(12,13)14/h1,4-6,8-9H,2H2,(H,10,11)(H2,12,13,14)/t4-,5-,6+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 254.131 g/mol | logS: 0.68749 | SlogP: -2.4694 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.14823 | Sterimol/B1: 3.45089 | Sterimol/B2: 3.52566 | Sterimol/B3: 3.62529 |
Sterimol/B4: 5.26672 | Sterimol/L: 12.2504 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 417.007 | Positive charged surface: 244.146 | Negative charged surface: 172.862 | Volume: 190 |
Hydrophobic surface: 78.8787 | Hydrophilic surface: 338.1283 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|