Type: Neutral
Formula: C18H16ClFN4O2
SMILES: |
Clc1ccc(OCC)c(F)c1C1CC1NC(=O)Nc1ncc(cc1)C#N |
InChI: |
InChI=1/C18H16ClFN4O2/c1-2-26-14-5-4-12(19)16(17(14)20)11-7-13(11)23-18(25)24-15-6-3-10(8-21)9-22-15/h3-6,9,11,13H,2,7H2,1H3,(H2,22,23,24,25)/t11-,13+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 374.803 g/mol | logS: -4.29364 | SlogP: 3.82208 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0586735 | Sterimol/B1: 2.33393 | Sterimol/B2: 2.57353 | Sterimol/B3: 4.04013 |
Sterimol/B4: 10.7372 | Sterimol/L: 17.2657 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 629.507 | Positive charged surface: 376.47 | Negative charged surface: 253.037 | Volume: 332.25 |
Hydrophobic surface: 443.209 | Hydrophilic surface: 186.298 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |