 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)C(NC1=NC=NC2=NC=NC12)CCC(O)=O |
| InChI: | InChI=1/C10H11N5O4/c16-6(17)2-1-5(10(18)19)15-9-7-8(12-3-11-7)13-4-14-9/h3-5,7H,1-2H2,(H,16,17)(H,18,19)(H,11,12,13,14,15)/t5-,7-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=36.4661 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 265.229 g/mol | logS: -1.46973 | SlogP: -0.8566 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.119828 | Sterimol/B1: 2.55602 | Sterimol/B2: 2.60029 | Sterimol/B3: 4.10529 | |||
| Sterimol/B4: 8.17806 | Sterimol/L: 12.0061 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 461.767 | Positive charged surface: 311.021 | Negative charged surface: 150.746 | Volume: 220.875 | |||
| Hydrophobic surface: 130.648 | Hydrophilic surface: 331.119 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
