Type: Neutral
Formula: C18H15FN4O3
SMILES: |
Fc1ccc(C(=O)C)c(O)c1C1CC1NC(=O)Nc1ncc(cc1)C#N |
InChI: |
InChI=1/C18H15FN4O3/c1-9(24)11-3-4-13(19)16(17(11)25)12-6-14(12)22-18(26)23-15-5-2-10(7-20)8-21-15/h2-5,8,12,14,25H,6H2,1H3,(H2,21,22,23,26)/t12-,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 354.341 g/mol | logS: -3.13208 | SlogP: 2.67818 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0520664 | Sterimol/B1: 2.38512 | Sterimol/B2: 3.6399 | Sterimol/B3: 5.30091 |
Sterimol/B4: 5.4615 | Sterimol/L: 20.2482 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 613.989 | Positive charged surface: 365.392 | Negative charged surface: 248.597 | Volume: 316 |
Hydrophobic surface: 357.519 | Hydrophilic surface: 256.47 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |