Type: Neutral
Formula: C12H20N2O5
SMILES: |
OC1CC(NC(=O)NC(=O)\C=C\OCC)CC1CO |
InChI: |
InChI=1/C12H20N2O5/c1-2-19-4-3-11(17)14-12(18)13-9-5-8(7-15)10(16)6-9/h3-4,8-10,15-16H,2,5-7H2,1H3,(H2,13,14,17,18)/b4-3+/t8-,9+,10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 272.301 g/mol | logS: -0.83591 | SlogP: -0.5058 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0229066 | Sterimol/B1: 2.8354 | Sterimol/B2: 2.86707 | Sterimol/B3: 3.51456 |
Sterimol/B4: 4.47666 | Sterimol/L: 19.9381 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 543.892 | Positive charged surface: 400.597 | Negative charged surface: 143.295 | Volume: 254 |
Hydrophobic surface: 326.96 | Hydrophilic surface: 216.932 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |