Type: Neutral
Formula: C4H13NO6P2
SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)(N)CCC |
InChI: |
InChI=1/C4H13NO6P2/c1-2-3-4(5,12(6,7)8)13(9,10)11/h2-3,5H2,1H3,(H2,6,7,8)(H2,9,10,11) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 233.097 g/mol | logS: 0.90102 | SlogP: -2.386 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.425159 | Sterimol/B1: 3.19135 | Sterimol/B2: 3.60859 | Sterimol/B3: 3.9933 |
Sterimol/B4: 5.5121 | Sterimol/L: 9.86107 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 371.342 | Positive charged surface: 220.079 | Negative charged surface: 151.263 | Volume: 175 |
Hydrophobic surface: 88.6431 | Hydrophilic surface: 282.6989 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |