Type: Neutral
Formula: C16H19N3O3
SMILES: |
O(CC)c1ccc(cc1)C1(NC(Cc2[nH]cnc12)C(O)=O)C |
InChI: |
InChI=1/C16H19N3O3/c1-3-22-11-6-4-10(5-7-11)16(2)14-12(17-9-18-14)8-13(19-16)15(20)21/h4-7,9,13,19H,3,8H2,1-2H3,(H,17,18)(H,20,21)/t13-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 301.346 g/mol | logS: -2.68785 | SlogP: 1.98227 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0968948 | Sterimol/B1: 2.92732 | Sterimol/B2: 4.67068 | Sterimol/B3: 4.75165 |
Sterimol/B4: 6.18853 | Sterimol/L: 15.1976 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 536.937 | Positive charged surface: 377.983 | Negative charged surface: 158.954 | Volume: 285.375 |
Hydrophobic surface: 354.614 | Hydrophilic surface: 182.323 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |