Type: Neutral
Formula: C20H28O3
SMILES: |
OC1CCC(C)(C)C(\C=C\C(=C/C=C\C(=C\C(O)=O)\C)\C)=C1C |
InChI: |
InChI=1/C20H28O3/c1-14(7-6-8-15(2)13-19(22)23)9-10-17-16(3)18(21)11-12-20(17,4)5/h6-10,13,18,21H,11-12H2,1-5H3,(H,22,23)/b8-6-,10-9+,14-7+,15-13-/t18-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 316.441 g/mol | logS: -6.25917 | SlogP: 4.5734 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.139383 | Sterimol/B1: 2.87993 | Sterimol/B2: 3.18024 | Sterimol/B3: 5.98387 |
Sterimol/B4: 6.31595 | Sterimol/L: 15.191 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 592.354 | Positive charged surface: 391.166 | Negative charged surface: 201.189 | Volume: 335.125 |
Hydrophobic surface: 426.286 | Hydrophilic surface: 166.068 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |