Type: Neutral
Formula: C21H29ClO
SMILES: |
ClCC(=O)\C=C(\C=C/C=C(\C=C\C=1C(CCCC=1C)(C)C)/C)/C |
InChI: |
InChI=1/C21H29ClO/c1-16(8-6-9-17(2)14-19(23)15-22)11-12-20-18(3)10-7-13-21(20,4)5/h6,8-9,11-12,14H,7,10,13,15H2,1-5H3/b9-6-,12-11+,16-8+,17-14- |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 332.915 g/mol | logS: -8.69822 | SlogP: 6.3259 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.151772 | Sterimol/B1: 2.44225 | Sterimol/B2: 3.84898 | Sterimol/B3: 5.56825 |
Sterimol/B4: 7.03893 | Sterimol/L: 15.9998 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 627.203 | Positive charged surface: 396.715 | Negative charged surface: 230.487 | Volume: 355.75 |
Hydrophobic surface: 500.096 | Hydrophilic surface: 127.107 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 0 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |