Type: Neutral
Formula: C14H25NO8
SMILES: |
O1C(C)C(NC2C=C(CO)C(O)C(O)C2O)C(O)C(O)C1OC |
InChI: |
InChI=1/C14H25NO8/c1-5-8(11(19)13(21)14(22-2)23-5)15-7-3-6(4-16)9(17)12(20)10(7)18/h3,5,7-21H,4H2,1-2H3/t5-,7-,8-,9-,10+,11+,12+,13-,14+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 335.353 g/mol | logS: 0.55145 | SlogP: -3.5588 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0678862 | Sterimol/B1: 2.41005 | Sterimol/B2: 2.78179 | Sterimol/B3: 4.43352 |
Sterimol/B4: 7.53967 | Sterimol/L: 14.898 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 545.411 | Positive charged surface: 435.76 | Negative charged surface: 109.651 | Volume: 300 |
Hydrophobic surface: 252.519 | Hydrophilic surface: 292.892 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 9 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |