 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(OC2C(O)C(N(C(=O)CN)C)C(O)CC2N)C(N)CCC1C(N)C |
| InChI: | InChI=1/C16H33N5O5/c1-7(18)11-4-3-8(19)16(25-11)26-15-9(20)5-10(22)13(14(15)24)21(2)12(23)6-17/h7-11,13-16,22,24H,3-6,17-20H2,1-2H3/t7-,8-,9+,10-,11+,13-,14-,15+,16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=259.236 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 375.47 g/mol | logS: 0.58631 | SlogP: -3.2103 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.310517 | Sterimol/B1: 2.96675 | Sterimol/B2: 4.62308 | Sterimol/B3: 4.66678 | |||
| Sterimol/B4: 7.0621 | Sterimol/L: 13.134 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 528.512 | Positive charged surface: 444.171 | Negative charged surface: 84.341 | Volume: 347.375 | |||
| Hydrophobic surface: 264.399 | Hydrophilic surface: 264.113 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 9 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
