Type: Neutral
Formula: C18H21N3O4
SMILES: |
O1CCCC1C\N=C\C=1C(=O)NC(=O)N(C=1O)c1cc(C)c(cc1)C |
InChI: |
InChI=1/C18H21N3O4/c1-11-5-6-13(8-12(11)2)21-17(23)15(16(22)20-18(21)24)10-19-9-14-4-3-7-25-14/h5-6,8,10,14,23H,3-4,7,9H2,1-2H3,(H,20,22,24)/b19-10+/t14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 343.383 g/mol | logS: -3.87398 | SlogP: 2.37904 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0680954 | Sterimol/B1: 2.41723 | Sterimol/B2: 3.48204 | Sterimol/B3: 4.36389 |
Sterimol/B4: 6.74578 | Sterimol/L: 18.0068 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 609.754 | Positive charged surface: 430.979 | Negative charged surface: 178.775 | Volume: 324 |
Hydrophobic surface: 449.256 | Hydrophilic surface: 160.498 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |