 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)N1CCCC1C(=O)C(NC(CCc1ccccc1)C(=O)[O-])C |
| InChI: | InChI=1/C18H24N2O5/c1-12(16(21)15-8-5-11-20(15)18(24)25)19-14(17(22)23)10-9-13-6-3-2-4-7-13/h2-4,6-7,12,14-15,19H,5,8-11H2,1H3,(H,22,23)(H,24,25)/p-1/t12-,14-,15+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=53.6229 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 347.391 g/mol | logS: -2.58692 | SlogP: 0.42727 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.156874 | Sterimol/B1: 3.11248 | Sterimol/B2: 3.61846 | Sterimol/B3: 4.52011 | |||
| Sterimol/B4: 8.27391 | Sterimol/L: 14.7306 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 598.247 | Positive charged surface: 358.287 | Negative charged surface: 239.96 | Volume: 333.5 | |||
| Hydrophobic surface: 405.442 | Hydrophilic surface: 192.805 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
