 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)C(NC(=O)C(NC)C(CC)C)CCC1C=CC(N)C=C1 |
| InChI: | InChI=1/C17H29N3O3/c1-4-11(2)15(19-3)16(21)20-14(17(22)23)10-7-12-5-8-13(18)9-6-12/h5-6,8-9,11-15,19H,4,7,10,18H2,1-3H3,(H,20,21)(H,22,23)/t11-,12-,13-,14-,15+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=59.3307 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 323.437 g/mol | logS: -2.09717 | SlogP: 1.0396 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.073271 | Sterimol/B1: 2.05307 | Sterimol/B2: 3.09258 | Sterimol/B3: 4.11121 | |||
| Sterimol/B4: 10.204 | Sterimol/L: 15.8347 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 615.399 | Positive charged surface: 445.834 | Negative charged surface: 169.565 | Volume: 331.875 | |||
| Hydrophobic surface: 345.184 | Hydrophilic surface: 270.215 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.