 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(Cc1c2c([nH]c1)cccc2)C(=O)[O-])CNC(=O)\C=C(\O)/C |
| InChI: | InChI=1/C17H19N3O5/c1-10(21)6-15(22)19-9-16(23)20-14(17(24)25)7-11-8-18-13-5-3-2-4-12(11)13/h2-6,8,14,18,21H,7,9H2,1H3,(H,19,22)(H,20,23)(H,24,25)/p-1/b10-6+/t14-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=48.3408 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 344.347 g/mol | logS: -2.4985 | SlogP: -0.47693 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.089392 | Sterimol/B1: 3.5668 | Sterimol/B2: 4.04856 | Sterimol/B3: 5.51715 | |||
| Sterimol/B4: 6.79088 | Sterimol/L: 15.3892 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 603.209 | Positive charged surface: 340.935 | Negative charged surface: 259.397 | Volume: 315.625 | |||
| Hydrophobic surface: 356.327 | Hydrophilic surface: 246.882 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
